CAS 1310384-32-7
:B-[6-(Diethylamino)-2-pyridinyl]boronic acid
Description:
B-[6-(Diethylamino)-2-pyridinyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring that is further substituted with a diethylamino group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications including organic synthesis and medicinal chemistry. The diethylamino group enhances its solubility in organic solvents and may influence its reactivity and interaction with biological targets. The compound is likely to be a solid at room temperature, with potential applications in drug development, particularly in the design of inhibitors for certain enzymes or in the development of targeted therapies. Additionally, its boronic acid functionality allows for participation in Suzuki coupling reactions, a key method in the formation of carbon-carbon bonds in organic synthesis. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.
Formula:C9H15BN2O2
InChI:InChI=1S/C9H15BN2O2/c1-3-12(4-2)9-7-5-6-8(11-9)10(13)14/h5-7,13-14H,3-4H2,1-2H3
InChI key:InChIKey=RBKYYJRQRLNULP-UHFFFAOYSA-N
SMILES:N(CC)(CC)C=1N=C(B(O)O)C=CC1
Synonyms:- B-[6-(Diethylamino)-2-pyridinyl]boronic acid
- Boronic acid, B-[6-(diethylamino)-2-pyridinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
