CAS 1310384-88-3

B-[6-(1,1-Dimethylethoxy)-2-pyridinyl]boronic acid

Description:

B-[6-(1,1-Dimethylethoxy)-2-pyridinyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the 1,1-dimethylethoxy group enhances its solubility and stability, which can be advantageous in synthetic processes. Additionally, the pyridine moiety contributes to its electronic properties, potentially influencing reactivity and interaction with biological targets. Boronic acids are often utilized in cross-coupling reactions, such as Suzuki-Miyaura coupling, which is significant in the formation of carbon-carbon bonds. Overall, B-[6-(1,1-Dimethylethoxy)-2-pyridinyl]boronic acid is a versatile compound with applications in both research and industrial settings, particularly in the development of pharmaceuticals and agrochemicals.

Formula: C₉H₁₄BNO₃

InChI: InChI=1S/C9H14BNO3/c1-9(2,3)14-8-6-4-5-7(11-8)10(12)13/h4-6,12-13H,1-3H3

InChI key: InChIKey=HJLLSKFZQODXFO-UHFFFAOYSA-N

SMILES: O(C(C)(C)C)C=1N=C(B(O)O)C=CC1

Synonyms:

• B-[6-(1,1-Dimethylethoxy)-2-pyridinyl]boronic acid
• Boronic acid, B-[6-(1,1-dimethylethoxy)-2-pyridinyl]-

(6-(tert-Butoxy)pyridin-2-yl)boronic acid

CAS: 1310384-88-3

Formula: C₉H₁₄BNO₃

Molecular weight: 195.0234

Ref: IN-DA000VEO