CymitQuimica logo

CAS 1310384-89-4

:

4-Methyl-3-nitro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine

Description:
4-Methyl-3-nitro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is an organic compound characterized by its complex structure, which includes a pyridine ring substituted with a methyl and a nitro group, as well as a boron-containing moiety. The presence of the nitro group typically imparts electrophilic characteristics, making the compound potentially reactive in various chemical reactions. The boron-containing group, specifically the dioxaborolane, is known for its utility in organic synthesis, particularly in cross-coupling reactions and as a reagent in the formation of carbon-boron bonds. This compound may exhibit solubility in organic solvents, and its reactivity can be influenced by the electronic effects of the substituents on the pyridine ring. Additionally, the presence of the tetramethyl substituents can enhance the steric bulk around the boron atom, potentially affecting its reactivity and interactions with other chemical species. Overall, this compound is of interest in synthetic organic chemistry and may have applications in the development of pharmaceuticals or agrochemicals.
Formula:C12H17BN2O4
InChI:InChI=1S/C12H17BN2O4/c1-8-6-7-14-10(9(8)15(16)17)13-18-11(2,3)12(4,5)19-13/h6-7H,1-5H3
InChI key:InChIKey=TZBRCSACIZZAAW-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(N=CC=C1C)B2OC(C)(C)C(C)(C)O2
Synonyms:
  • Pyridine, 4-methyl-3-nitro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 4-Methyl-3-nitro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.