CymitQuimica logo

CAS 1310385-00-2

:

B-[4-(1-Hydroxy-1-methylethyl)-2-pyridinyl]boronic acid

Description:
B-[4-(1-Hydroxy-1-methylethyl)-2-pyridinyl]boronic acid, identified by its CAS number 1310385-00-2, is a boronic acid derivative characterized by the presence of a pyridine ring and a hydroxymethyl substituent. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The hydroxyl group enhances its solubility in polar solvents and contributes to its reactivity. Additionally, the pyridine moiety can participate in coordination chemistry, potentially interacting with metal ions. The compound may also exhibit biological activity, which is of interest in drug development, particularly in the context of targeting specific enzymes or receptors. Its structural features suggest potential applications in the development of sensors or as intermediates in the synthesis of more complex molecules. Overall, B-[4-(1-Hydroxy-1-methylethyl)-2-pyridinyl]boronic acid is a versatile compound with significant implications in both research and industrial settings.
Formula:C8H12BNO3
InChI:InChI=1S/C8H12BNO3/c1-8(2,11)6-3-4-10-7(5-6)9(12)13/h3-5,11-13H,1-2H3
InChI key:InChIKey=LSXVCYFWLXDKSK-UHFFFAOYSA-N
SMILES:C(C)(C)(O)C=1C=C(B(O)O)N=CC1
Synonyms:
  • Boronic acid, B-[4-(1-hydroxy-1-methylethyl)-2-pyridinyl]-
  • B-[4-(1-Hydroxy-1-methylethyl)-2-pyridinyl]boronic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.