CymitQuimica logo

CAS 1310385-02-4

:

N,N-Dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinamine

Description:
N,N-Dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinamine is a chemical compound characterized by its unique structural features, which include a pyridine ring and a boron-containing dioxaborolane moiety. The presence of the dimethylamino group enhances its solubility and reactivity, making it a potential candidate for various applications in organic synthesis and medicinal chemistry. The dioxaborolane group is known for its ability to participate in boron-mediated reactions, which can be advantageous in the formation of carbon-boron bonds. This compound may exhibit properties such as moderate to high polarity due to the nitrogen and boron functionalities, influencing its interaction with other molecules. Additionally, the steric hindrance provided by the tetramethyl groups can affect its reactivity and stability. Overall, this compound's distinctive features suggest potential utility in fields such as drug development, materials science, and catalysis, although specific applications would depend on further research and characterization.
Formula:C13H21BN2O2
InChI:InChI=1S/C13H21BN2O2/c1-12(2)13(3,4)18-14(17-12)10-8-7-9-11(15-10)16(5)6/h7-9H,1-6H3
InChI key:InChIKey=QVOVJYWZHFIBHU-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2N=C(N(C)C)C=CC2
Synonyms:
  • N,N-Dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinamine
  • 2-Pyridinamine, N,N-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • N,N-Dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.