
CAS 1310385-05-7
:1,1-Dimethylethyl N-[4-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]carbamate
Description:
1,1-Dimethylethyl N-[4-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]carbamate, identified by its CAS number 1310385-05-7, is a chemical compound characterized by its complex structure, which includes a carbamate functional group and a pyridine ring. The presence of the tetramethyl-1,3,2-dioxaborolane moiety suggests potential applications in organoboron chemistry, particularly in cross-coupling reactions or as a reagent in organic synthesis. The compound's dimethyl and ethyl substituents contribute to its steric properties, potentially influencing its reactivity and solubility. It may exhibit specific biological activities due to the pyridine component, which is often associated with pharmacological properties. The stability of the compound can be affected by environmental factors such as temperature and pH, and it may require careful handling due to the presence of boron, which can have unique interactions in biological systems. Overall, this compound represents a specialized class of organic molecules with potential utility in both synthetic and medicinal chemistry.
Formula:C17H27BN2O4
InChI:InChI=1S/C17H27BN2O4/c1-11-9-10-19-13(12(11)20-14(21)22-15(2,3)4)18-23-16(5,6)17(7,8)24-18/h9-10H,1-8H3,(H,20,21)
InChI key:InChIKey=MBDUEZDXNKIRSM-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)C1=C(B2OC(C)(C)C(C)(C)O2)N=CC=C1C
Synonyms:- 1,1-Dimethylethyl N-[4-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]carbamate
- Carbamic acid, N-[4-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl (4-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-yl)carbamate
CAS:Formula:C17H27BN2O4Molecular weight:334.2183
