CAS 13104-56-8
:4'-(4-methoxyphenyl)-2,2',6',2''-terpyridine
Description:
4'-(4-Methoxyphenyl)-2,2',6',2''-terpyridine, with the CAS number 13104-56-8, is an organic compound characterized by its complex structure, which includes a terpyridine core substituted with a methoxyphenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for coordination with metal ions due to the presence of nitrogen atoms in the terpyridine framework. The methoxy group enhances its solubility in organic solvents and may influence its electronic properties, making it useful in various applications, including coordination chemistry and materials science. Additionally, the compound may display interesting photophysical properties, which can be leveraged in the development of sensors or light-harvesting systems. Its structural features suggest potential reactivity in organic synthesis, particularly in the formation of metal complexes or as a ligand in catalysis. Overall, 4'-(4-Methoxyphenyl)-2,2',6',2''-terpyridine is a versatile compound with significant implications in both academic research and industrial applications.
Formula:C22H17N3O
InChI:InChI=1/C22H17N3O/c1-26-18-10-8-16(9-11-18)17-14-21(19-6-2-4-12-23-19)25-22(15-17)20-7-3-5-13-24-20/h2-15H,1H3
SMILES:COc1ccc(cc1)c1cc(c2ccccn2)nc(c1)c1ccccn1
Synonyms:- 4'-(4-Methoxyphenyl)-2,2'
- 6',2''-Terpyridin
- 6',2''-Terpyridine
- 4-(p-Methoxyphenyl)-2,6-di(2-pyridyl)pyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4'-(4-Methoxyphenyl)-2,2':6',2″-terpyridine, 98%
CAS:<p>4'-(4-Methoxyphenyl)-2,2':6',2&Prime;-terpyridine is used as an organic chemical synthesis intermediate.This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Ae</p>Formula:C22H17N3OPurity:98%Color and Shape:White, PowderMolecular weight:339.402,2':6',2''-Terpyridine, 4'-(4-methoxyphenyl)-
CAS:Formula:C22H17N3OPurity:95%Color and Shape:SolidMolecular weight:339.38994'-(4-Methoxyphenyl)-2,2':6',2''-terpyridine
CAS:4'-(4-Methoxyphenyl)-2,2':6',2''-terpyridinePurity:97%Molecular weight:339.40g/mol4'-(4-Methoxyphenyl)-2,2':6',2''-terpyridine
CAS:Formula:C22H17N3OPurity:>97.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:339.40




