CymitQuimica logo

CAS 1310403-86-1

:

Boronic acid, B-6-quinolinyl-, hydrochloride (1:1)

Description:
Boronic acid, B-6-quinolinyl-, hydrochloride (1:1) is a chemical compound characterized by the presence of a boronic acid functional group attached to a quinoline moiety. This compound typically exhibits properties associated with both boronic acids and quinoline derivatives, including potential applications in medicinal chemistry and organic synthesis. The boronic acid group is known for its ability to form reversible covalent bonds with diols, making it useful in various chemical reactions, including Suzuki coupling. The hydrochloride form indicates that the compound is a salt, which can enhance its solubility in polar solvents. This compound may also exhibit biological activity, potentially acting as a ligand or a precursor in drug development. Its structure suggests that it could interact with biological targets, making it of interest in pharmaceutical research. As with many boronic acids, it may also be sensitive to moisture and air, necessitating careful handling and storage conditions. Overall, this compound represents a versatile building block in organic chemistry with potential applications in various fields.
Formula:C9H8BNO2·ClH
InChI:InChI=1S/C9H8BNO2.ClH/c12-10(13)8-3-4-9-7(6-8)2-1-5-11-9;/h1-6,12-13H;1H
InChI key:InChIKey=XEUWKJJLVYUQIS-UHFFFAOYSA-N
SMILES:B(O)(O)C1=CC2=C(C=C1)N=CC=C2.Cl
Synonyms:
  • Boronic acid, B-6-quinolinyl-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.