CAS 1310403-93-0: Boronic acid, B-(5-formyl-4-methyl-3-thienyl)-

Description:Boronic acids are a class of organic compounds characterized by the presence of a boron atom bonded to a hydroxyl group and an organic substituent. The specific compound "Boronic acid, B-(5-formyl-4-methyl-3-thienyl)-" features a thienyl group, which is a five-membered aromatic ring containing sulfur. This compound likely exhibits properties typical of boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the formyl group suggests potential reactivity in condensation reactions, while the methyl group may influence the compound's solubility and stability. Additionally, the thienyl moiety can impart unique electronic and steric properties, which may affect the compound's reactivity and interactions with other molecules. Overall, this boronic acid derivative may serve as a valuable building block in the development of pharmaceuticals or as a ligand in coordination chemistry.

Formula:C₆H₇BO₃S

InChI:InChI=1S/C6H7BO3S/c1-4-5(7(9)10)3-11-6(4)2-8/h2-3,9-10H,1H3

InChI key:InChIKey=IQSYUVVZXOQDMC-UHFFFAOYSA-N

SMILES:O=CC=1SC=C(B(O)O)C1C

Synonyms:
Boronic acid, B-(5-formyl-4-methyl-3-thienyl)-
4-(Dihydroxyboranyl)-3-methylthiophene-2-carbaldehyde
(5-Formyl-4-methylthiophen-3-yl)boronic acid

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Boronic acid, B-(5-formyl-4-methyl-3-thienyl)- REF: IN-DA01PLVWCAS: 1310403-93-0	- - -	To inquire	Fri 28 Mar 25
2-Formyl-3-methylthiophene-4-boronic acid REF: 10-F623779CAS: 1310403-93-0	95+%	- - -	Discontinued product
2-Formyl-3-methylthiophene-4-boronic acid REF: 3D-KCC40393CAS: 1310403-93-0	Min. 95%	- - -	Discontinued product