CAS 1310404-05-7

B-(4-Amino-2-pyridinyl)boronic acid

Description:

B-(4-Amino-2-pyridinyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring that has an amino substituent. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar solvents like water and alcohols, and possessing a moderate melting point. The boronic acid moiety allows for the formation of reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and materials science. The amino group enhances its reactivity and potential for further functionalization. Additionally, this compound may exhibit biological activity, particularly in the context of drug development, where boron-containing compounds are explored for their ability to interact with biological targets. Its unique structural features contribute to its utility in synthetic chemistry, particularly in the development of pharmaceuticals and agrochemicals. As with many boronic acids, it is important to handle this substance with care, considering its potential reactivity and the need for proper storage conditions.

Formula: C₅H₇BN₂O₂

InChI: InChI=1S/C5H7BN2O2/c7-4-1-2-8-5(3-4)6(9)10/h1-3,9-10H,(H2,7,8)

InChI key: InChIKey=NKITZSPVMYSQLD-UHFFFAOYSA-N

SMILES: B(O)(O)C1=CC(N)=CC=N1

Synonyms:

• Boronic acid, B-(4-amino-2-pyridinyl)-
• B-(4-Amino-2-pyridinyl)boronic acid