CAS 1310404-07-9
:B-(5-Formyl-2-pyridinyl)boronic acid
Description:
B-(5-Formyl-2-pyridinyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group and a pyridine ring with a formyl substituent. This compound typically exhibits properties associated with both boronic acids and pyridine derivatives, including the ability to form reversible covalent bonds with diols, making it useful in various applications such as organic synthesis and medicinal chemistry. The presence of the formyl group introduces reactivity that can facilitate further chemical transformations, while the pyridine moiety contributes to its aromatic stability and potential for coordination with metal ions. Additionally, boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds. The compound's solubility and reactivity can vary depending on the solvent and conditions, making it a versatile building block in the synthesis of more complex organic molecules. Overall, B-(5-Formyl-2-pyridinyl)boronic acid is a valuable compound in the field of organic chemistry, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C6H6BNO3
InChI:InChI=1S/C6H6BNO3/c9-4-5-1-2-6(7(10)11)8-3-5/h1-4,10-11H
InChI key:InChIKey=GGOXLPCTWDZMCE-UHFFFAOYSA-N
SMILES:B(O)(O)C1=CC=C(C=O)C=N1
Synonyms:- Boronic acid, B-(5-formyl-2-pyridinyl)-
- B-(5-Formyl-2-pyridinyl)boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
B-(5-Formyl-2-pyridinyl)boronic Acid Monohydrate
CAS:Controlled ProductApplications B-(5-Formyl-2-pyridinyl)boronic Acid is used as a reagent in the preparation of (hetero)biarylsulfonamides as κ opioid antagonists with selectivity over the μ receptor.
References Verhoest, P. R., et al.: J. Med. Chem., 54, 5868 (2011);Formula:C6H6BNO3•H2OColor and Shape:NeatMolecular weight:150.93 + 18.02

