CAS 1310404-10-4
:B-[6-(2-Methyl-1H-imidazol-1-yl)-2-pyridinyl]boronic acid
Description:
B-[6-(2-Methyl-1H-imidazol-1-yl)-2-pyridinyl]boronic acid is a boronic acid derivative characterized by its unique structural features, which include a boron atom bonded to a phenyl ring and a pyridine moiety substituted with an imidazole group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the imidazole and pyridine rings contributes to its potential biological activity, possibly enhancing its interaction with biological targets. Additionally, boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds in organic synthesis. The compound's solubility and stability can vary depending on the solvent and pH, which are important considerations for its practical applications. Overall, B-[6-(2-Methyl-1H-imidazol-1-yl)-2-pyridinyl]boronic acid represents a versatile building block in chemical research and development.
Formula:C9H10BN3O2
InChI:InChI=1S/C9H10BN3O2/c1-7-11-5-6-13(7)9-4-2-3-8(12-9)10(14)15/h2-6,14-15H,1H3
InChI key:InChIKey=WBYDEDQTWOGCIV-UHFFFAOYSA-N
SMILES:CC=1N(C=2N=C(B(O)O)C=CC2)C=CN1
Synonyms:- Boronic acid, B-[6-(2-methyl-1H-imidazol-1-yl)-2-pyridinyl]-
- B-[6-(2-Methyl-1H-imidazol-1-yl)-2-pyridinyl]boronic acid
- (6-(2-Methyl-1H-imidazol-1-yl)-pyridin-2-yl)boronic acid
- 6-(2-METHYLIMIDAZOL-1-YL)PYRIDINE-2-BORONIC ACID
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(6-(2-Methyl-1H-imidazol-1-yl)pyridin-2-yl)boronic acid
CAS:Formula:C9H10BN3O2Molecular weight:203.0056
