CymitQuimica logo

CAS 1310404-12-6

:

2-(3-Methyl-1H-pyrazol-1-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine

Description:
2-(3-Methyl-1H-pyrazol-1-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, identified by CAS number 1310404-12-6, is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a pyrazole moiety and a boron-containing dioxaborolane group. This compound exhibits properties typical of heterocyclic compounds, including potential applications in medicinal chemistry and materials science due to its unique electronic and steric characteristics. The presence of the boron atom suggests potential reactivity in cross-coupling reactions, making it of interest in organic synthesis. Additionally, the methyl and tetramethyl groups contribute to its lipophilicity and may influence its solubility and stability in various solvents. The compound's specific interactions and reactivity can be further explored through experimental studies, which may reveal its utility in drug development or as a ligand in coordination chemistry. Overall, this compound represents a fascinating example of modern synthetic chemistry, combining elements from different chemical classes to create novel functionalities.
Formula:C15H20BN3O2
InChI:InChI=1S/C15H20BN3O2/c1-11-9-10-19(18-11)13-8-6-7-12(17-13)16-20-14(2,3)15(4,5)21-16/h6-10H,1-5H3
InChI key:InChIKey=ISYOZSMFFXJXMS-UHFFFAOYSA-N
SMILES:CC1(C)OB(C=2N=C(C=CC2)N3N=C(C)C=C3)OC1(C)C
Synonyms:
  • 2-(3-Methylpyrazol-1-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
  • 2-(3-Methyl-1H-pyrazol-1-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
  • Pyridine, 2-(3-methyl-1H-pyrazol-1-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.