CymitQuimica logo

CAS 1310404-13-7

:

2-(3-Methyl-1-piperidinyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine

Description:
2-(3-Methyl-1-piperidinyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a piperidine moiety and a boron-containing dioxaborolane group. The presence of the piperidine ring contributes to its potential biological activity, as piperidine derivatives are often associated with various pharmacological properties. The dioxaborolane group enhances the compound's stability and may facilitate interactions in chemical reactions, particularly in organoboron chemistry. This compound is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its polar and nonpolar functional groups. Its unique structure suggests potential applications in medicinal chemistry, particularly in the development of new pharmaceuticals or agrochemicals. However, specific properties such as melting point, boiling point, and reactivity would require empirical data for precise characterization. Safety and handling precautions should be observed, as with all chemical substances, particularly those containing boron and nitrogen functionalities.
Formula:C17H27BN2O2
InChI:InChI=1S/C17H27BN2O2/c1-13-8-7-11-20(12-13)15-10-6-9-14(19-15)18-21-16(2,3)17(4,5)22-18/h6,9-10,13H,7-8,11-12H2,1-5H3
InChI key:InChIKey=JGOABNYRXBZVBO-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2N=C(C=CC2)N3CC(C)CCC3
Synonyms:
  • Pyridine, 2-(3-methyl-1-piperidinyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 2-(3-Methyl-1-piperidinyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.