
CAS 1310404-17-1
:2-Methyl 6-borono-2-pyridinecarboxylate
Description:
2-Methyl 6-borono-2-pyridinecarboxylate is an organoboron compound characterized by the presence of a boron atom attached to a pyridine ring, which is further substituted with a carboxylate group and a methyl group. This compound typically exhibits a polar nature due to the presence of the carboxylate functional group, which can engage in hydrogen bonding and ionic interactions. The boron atom in the structure can participate in coordination chemistry, making it useful in various synthetic applications, particularly in the formation of carbon-boron bonds. The methyl group contributes to the compound's hydrophobic characteristics, influencing its solubility in organic solvents. Additionally, the pyridine ring provides aromatic stability and can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Overall, 2-Methyl 6-borono-2-pyridinecarboxylate is a versatile compound with potential applications in organic synthesis, medicinal chemistry, and materials science.
Formula:C7H8BNO4
InChI:InChI=1S/C7H8BNO4/c1-13-7(10)5-3-2-4-6(9-5)8(11)12/h2-4,11-12H,1H3
InChI key:InChIKey=KNNCQFYLDANBIJ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1N=C(B(O)O)C=CC1
Synonyms:- Methyl 6-(dihydroxyboranyl)pyridine-2-carboxylate
- 2-Methyl 6-borono-2-pyridinecarboxylate
- 2-Pyridinecarboxylic acid, 6-borono-, 2-methyl ester
- (6-(Methoxycarbonyl)pyridin-2-yl)boronicacid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
