CymitQuimica logo

CAS 1310404-20-6

:

4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinecarboxaldehyde

Description:
4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinecarboxaldehyde is an organic compound characterized by its unique structure, which includes a pyridine ring and a dioxaborolane moiety. The presence of the dioxaborolane group suggests that this compound may exhibit properties related to boron chemistry, such as potential reactivity in cross-coupling reactions or as a boron-containing building block in organic synthesis. The aldehyde functional group (–CHO) indicates that it can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The compound's molecular structure contributes to its solubility and reactivity, making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the presence of multiple methyl groups enhances its steric bulk, which can influence its reactivity and interactions with other molecules. Overall, this compound represents a versatile intermediate in the field of organic synthesis, with potential applications in various chemical processes.
Formula:C12H16BNO3
InChI:InChI=1S/C12H16BNO3/c1-11(2)12(3,4)17-13(16-11)10-5-6-14-7-9(10)8-15/h5-8H,1-4H3
InChI key:InChIKey=QYYPSQCYZQLFIL-UHFFFAOYSA-N
SMILES:C(=O)C=1C(=CC=NC1)B2OC(C)(C)C(C)(C)O2
Synonyms:
  • 3-Pyridinecarboxaldehyde, 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinecarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.