CymitQuimica logo

CAS 1310404-50-2

:

2-Bromo-5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine

Description:
2-Bromo-5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is an organic compound characterized by its complex structure, which includes a pyridine ring substituted with a bromine atom and a boron-containing moiety. The presence of the bromine atom indicates potential reactivity, particularly in nucleophilic substitution reactions. The tetramethyl-1,3,2-dioxaborolane group contributes to the compound's stability and solubility in organic solvents, making it useful in various synthetic applications, including cross-coupling reactions in organic synthesis. The methyl group on the pyridine ring can influence the electronic properties and steric hindrance, affecting the compound's reactivity. This compound is of interest in medicinal chemistry and materials science due to its potential applications in drug development and as a building block in the synthesis of more complex molecules. Its unique structural features make it a valuable candidate for further research in the field of organoboron chemistry.
Formula:C12H17BBrNO2
InChI:InChI=1S/C12H17BBrNO2/c1-8-6-9(10(14)15-7-8)13-16-11(2,3)12(4,5)17-13/h6-7H,1-5H3
InChI key:InChIKey=RARGTIKJOZJYGK-UHFFFAOYSA-N
SMILES:BrC1=C(B2OC(C)(C)C(C)(C)O2)C=C(C)C=N1
Synonyms:
  • Pyridine, 2-bromo-5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 2-Bromo-5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.