CAS 1310404-55-7
:2-(1,1-Dimethylethoxy)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Description:
2-(1,1-Dimethylethoxy)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted with a dimethylethoxy group and a boron-containing dioxaborolane moiety. The presence of the pyridine ring imparts basicity and potential for coordination with metal ions, while the dioxaborolane group enhances its reactivity in various chemical transformations, particularly in cross-coupling reactions. This compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic groups, and it may participate in reactions typical of boron-containing compounds, such as nucleophilic attacks or ligand exchange. Its specific applications could include use in organic synthesis, medicinal chemistry, or materials science, particularly in the development of boron-containing pharmaceuticals or catalysts. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use.
Formula:C15H24BNO3
InChI:InChI=1S/C15H24BNO3/c1-13(2,3)18-12-10-8-9-11(17-12)16-19-14(4,5)15(6,7)20-16/h8-10H,1-7H3
InChI key:InChIKey=IQVQXYNEEAIOST-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2N=C(OC(C)(C)C)C=CC2
Synonyms:- 2-(1,1-Dimethylethoxy)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
- Pyridine, 2-(1,1-dimethylethoxy)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
