CAS 1310404-56-8

B-[5-(1-Hydroxy-1-methylethyl)-3-pyridinyl]boronic acid

Description:

B-[5-(1-Hydroxy-1-methylethyl)-3-pyridinyl]boronic acid, with the CAS number 1310404-56-8, is a boronic acid derivative characterized by the presence of a pyridine ring substituted with a hydroxyisopropyl group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the pyridine moiety contributes to its potential biological activity, as pyridine derivatives are often involved in drug design due to their ability to interact with biological targets. Additionally, the hydroxy group enhances its solubility in polar solvents and may influence its reactivity and stability. Overall, this compound is of interest in research areas focusing on drug development and materials science, particularly in the context of developing boron-based compounds for therapeutic applications.

Formula: C₈H₁₂BNO₃

InChI: InChI=1S/C8H12BNO3/c1-8(2,11)6-3-7(9(12)13)5-10-4-6/h3-5,11-13H,1-2H3

InChI key: InChIKey=GRDBBBJVJPPVCL-UHFFFAOYSA-N

SMILES: C(C)(C)(O)C=1C=C(B(O)O)C=NC1

(5-(2-Hydroxypropan-2-yl)pyridin-3-yl)boronic acid

CAS: 1310404-56-8

Formula: C₈H₁₂BNO₃

Molecular weight: 180.9968

Ref: IN-DA000VEY