CAS 1310404-58-0
:B-[2-(2,2,2-Trifluoroacetyl)-4-pyridinyl]boronic acid
Description:
B-[2-(2,2,2-Trifluoroacetyl)-4-pyridinyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group and a pyridine ring substituted with a trifluoroacetyl group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The trifluoroacetyl group enhances the compound's lipophilicity and may influence its biological activity. Additionally, the presence of fluorine atoms can impart unique electronic properties, potentially affecting the compound's reactivity and interaction with biological targets. B-[2-(2,2,2-Trifluoroacetyl)-4-pyridinyl]boronic acid may also exhibit moderate solubility in organic solvents and limited solubility in water, which is common for many boronic acids. Overall, this compound's structural features suggest potential utility in drug development and as a building block in the synthesis of more complex molecules.
Formula:C7H5BF3NO3
InChI:InChI=1S/C7H5BF3NO3/c9-7(10,11)6(13)5-3-4(8(14)15)1-2-12-5/h1-3,14-15H
InChI key:InChIKey=JCUPTTRMSGGKLE-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(=O)C1=CC(B(O)O)=CC=N1
Synonyms:- B-[2-(2,2,2-Trifluoroacetyl)-4-pyridinyl]boronic acid
- Boronic acid, B-[2-(2,2,2-trifluoroacetyl)-4-pyridinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
