CymitQuimica logo

CAS 1310404-60-4

:

B-(5-Amino-2-methyl-4-pyridinyl)boronic acid

Description:
B-(5-Amino-2-methyl-4-pyridinyl)boronic acid, identified by its CAS number 1310404-60-4, is a boronic acid derivative characterized by the presence of a boron atom bonded to a pyridine ring that contains an amino group and a methyl substituent. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various chemical applications, including drug development and organic synthesis. The amino group contributes to its potential as a ligand in coordination chemistry, while the pyridine ring can participate in π-π stacking interactions, enhancing its biological activity. Additionally, the presence of the boronic acid functional group allows for potential applications in medicinal chemistry, particularly in the design of inhibitors for certain enzymes. Overall, this compound's unique structural features enable it to play a significant role in both synthetic and biological chemistry contexts.
Formula:C6H9BN2O2
InChI:InChI=1S/C6H9BN2O2/c1-4-2-5(7(10)11)6(8)3-9-4/h2-3,10-11H,8H2,1H3
InChI key:InChIKey=FWXXBIKSSQIKLV-UHFFFAOYSA-N
SMILES:B(O)(O)C=1C(N)=CN=C(C)C1
Synonyms:
  • B-(5-Amino-2-methyl-4-pyridinyl)boronic acid
  • Boronic acid, B-(5-amino-2-methyl-4-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.