CAS 1310404-64-8

B-(6-Chloro-2-pyrazinyl)boronic acid

Description:

B-(6-Chloro-2-pyrazinyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyrazine ring that is substituted with a chlorine atom. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar solvents like water and alcohols, and possessing a moderate melting point. The boronic acid moiety allows for participation in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The presence of the chloro substituent can influence its reactivity and interaction with biological targets. Additionally, this compound may exhibit potential applications in drug development, particularly in the design of inhibitors or other bioactive molecules. Its unique structure and functional groups contribute to its utility in various chemical and pharmaceutical applications, highlighting the importance of organoboron compounds in modern chemistry.

Formula: C₄H₄BClN₂O₂

InChI: InChI=1S/C4H4BClN2O2/c6-4-2-7-1-3(8-4)5(9)10/h1-2,9-10H

InChI key: InChIKey=YVNZXZFLVPLRTL-UHFFFAOYSA-N

SMILES: B(O)(O)C1=NC(Cl)=CN=C1

Synonyms:

• Boronic acid, B-(6-chloro-2-pyrazinyl)-
• B-(6-Chloro-2-pyrazinyl)boronic acid