CAS 1310404-64-8
:B-(6-Chloro-2-pyrazinyl)boronic acid
Description:
B-(6-Chloro-2-pyrazinyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyrazine ring that is substituted with a chlorine atom. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar solvents like water and alcohols, and possessing a moderate melting point. The boronic acid moiety allows for participation in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The presence of the chloro substituent can influence its reactivity and interaction with biological targets. Additionally, this compound may exhibit potential applications in drug development, particularly in the design of inhibitors or other bioactive molecules. Its unique structure and functional groups contribute to its utility in various chemical and pharmaceutical applications, highlighting the importance of organoboron compounds in modern chemistry.
Formula:C4H4BClN2O2
InChI:InChI=1S/C4H4BClN2O2/c6-4-2-7-1-3(8-4)5(9)10/h1-2,9-10H
InChI key:InChIKey=YVNZXZFLVPLRTL-UHFFFAOYSA-N
SMILES:B(O)(O)C1=NC(Cl)=CN=C1
Synonyms:- Boronic acid, B-(6-chloro-2-pyrazinyl)-
- B-(6-Chloro-2-pyrazinyl)boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.