CAS 1310404-85-3

5-Methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenamine

Description:

5-Methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenamine is an organic compound characterized by its complex structure, which includes a methoxy group and a dioxaborolane moiety. The presence of the methoxy group contributes to its potential as a nucleophile in various chemical reactions, while the dioxaborolane unit is known for its stability and ability to participate in boron-mediated reactions, such as Suzuki coupling. This compound may exhibit properties typical of amines, including basicity and the ability to form hydrogen bonds. Its unique structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the presence of boron in its structure may enhance its reactivity and selectivity in certain reactions. As with many organic compounds, its solubility, melting point, and reactivity would depend on the specific conditions and solvents used. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₃H₂₀BNO₃

InChI: InChI=1S/C13H20BNO3/c1-12(2)13(3,4)18-14(17-12)10-7-6-9(16-5)8-11(10)15/h6-8H,15H2,1-5H3

InChI key: InChIKey=AVWZIIGPVFTKIE-UHFFFAOYSA-N

SMILES: NC1=C(B2OC(C)(C)C(C)(C)O2)C=CC(OC)=C1

Synonyms:

• Benzenamine, 5-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
• 5-Methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenamine
• 5-Methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline
• 2-(2-Amino-4-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane