CymitQuimica logo

CAS 1310404-89-7

:

3-Methyl 2-borono-3-pyridinecarboxylate

Description:
3-Methyl 2-borono-3-pyridinecarboxylate is an organoboron compound characterized by the presence of a boron atom bonded to a pyridine ring, which is a six-membered aromatic heterocycle containing nitrogen. This compound features a methyl group at the 3-position of the pyridine ring and a carboxylate functional group, contributing to its reactivity and potential applications in organic synthesis. The boron atom in this structure typically exhibits a trigonal planar geometry, allowing for coordination with various nucleophiles, which is a key feature in many chemical reactions, including Suzuki coupling. The presence of the carboxylate group enhances its solubility in polar solvents and may influence its reactivity in various chemical transformations. Additionally, the compound may exhibit interesting biological properties, making it a candidate for further research in medicinal chemistry. Its unique structural features and functional groups make it a valuable intermediate in the synthesis of more complex organic molecules.
Formula:C7H8BNO4
InChI:InChI=1S/C7H8BNO4/c1-13-7(10)5-3-2-4-9-6(5)8(11)12/h2-4,11-12H,1H3
InChI key:InChIKey=UUVDDYLZAQNPFL-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(B(O)O)N=CC=C1
Synonyms:
  • 3-Methyl 2-borono-3-pyridinecarboxylate
  • 3-Pyridinecarboxylic acid, 2-borono-, 3-methyl ester
  • (3-(Methoxycarbonyl)pyridin-2-yl)boronicacid
  • Methyl 2-(dihydroxyboranyl)pyridine-3-carboxylate
  • 3-(Methoxycarbonyl)pyridine-2-boronic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.