
CAS 1310404-90-0
:B-[6-(Cyclobutyloxy)-2-pyridinyl]boronic acid
Description:
B-[6-(Cyclobutyloxy)-2-pyridinyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring that is further substituted with a cyclobutyloxy group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The cyclobutyloxy substituent contributes to the compound's steric and electronic properties, potentially influencing its reactivity and solubility. Boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds in organic synthesis. Additionally, the presence of the pyridine moiety may enhance the compound's ability to interact with biological targets, making it of interest in drug discovery and development. Overall, B-[6-(Cyclobutyloxy)-2-pyridinyl]boronic acid is a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C9H12BNO3
InChI:InChI=1S/C9H12BNO3/c12-10(13)8-5-2-6-9(11-8)14-7-3-1-4-7/h2,5-7,12-13H,1,3-4H2
InChI key:InChIKey=TXWBSQKQDYOHLG-UHFFFAOYSA-N
SMILES:O(C=1N=C(B(O)O)C=CC1)C2CCC2
Synonyms:- B-[6-(Cyclobutyloxy)-2-pyridinyl]boronic acid
- Boronic acid, B-[6-(cyclobutyloxy)-2-pyridinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
