CAS 1310405-01-6
:B-[5-(Hydroxymethyl)-2-pyridinyl]boronic acid
Description:
B-[5-(Hydroxymethyl)-2-pyridinyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring that has a hydroxymethyl substituent. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar solvents like water and alcohols, and possessing a moderate melting point. The boronic acid moiety allows for the formation of reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and materials science. It can participate in Suzuki-Miyaura cross-coupling reactions, which are significant in organic synthesis for forming carbon-carbon bonds. Additionally, the hydroxymethyl group can enhance the compound's reactivity and solubility, contributing to its utility in biological systems, particularly in drug design and development. Overall, B-[5-(Hydroxymethyl)-2-pyridinyl]boronic acid is a versatile compound with important implications in both synthetic and medicinal chemistry.
Formula:C6H8BNO3
InChI:InChI=1S/C6H8BNO3/c9-4-5-1-2-6(7(10)11)8-3-5/h1-3,9-11H,4H2
InChI key:InChIKey=HFEWXFFISPVQDU-UHFFFAOYSA-N
SMILES:B(O)(O)C1=CC=C(CO)C=N1
Synonyms:- (5-(Hydroxymethyl)pyridin-2-yl)boronic acid
- Boronic acid, B-[5-(hydroxymethyl)-2-pyridinyl]-
- B-[5-(Hydroxymethyl)-2-pyridinyl]boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
