CymitQuimica logo

CAS 1310405-08-3

:

B-(3-Amino-5-ethoxy-4-pyridinyl)boronic acid

Description:
B-(3-Amino-5-ethoxy-4-pyridinyl)boronic acid, identified by its CAS number 1310405-08-3, is a boronic acid derivative characterized by the presence of a pyridine ring substituted with an amino group and an ethoxy group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and organic synthesis. The amino group contributes to its potential as a ligand in coordination chemistry, while the ethoxy group enhances its solubility in organic solvents. Additionally, the presence of the pyridine moiety may impart unique electronic properties, influencing its reactivity and interaction with biological targets. Overall, this compound is of interest in the development of pharmaceuticals, particularly in the context of drug design and delivery systems, due to its ability to modulate biological activity through interactions with specific biomolecules.
Formula:C7H11BN2O3
InChI:InChI=1S/C7H11BN2O3/c1-2-13-6-4-10-3-5(9)7(6)8(11)12/h3-4,11-12H,2,9H2,1H3
InChI key:InChIKey=KGUJMQCOCWYHRB-UHFFFAOYSA-N
SMILES:B(O)(O)C=1C(OCC)=CN=CC1N
Synonyms:
  • B-(3-Amino-5-ethoxy-4-pyridinyl)boronic acid
  • Boronic acid, B-(3-amino-5-ethoxy-4-pyridinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.