CymitQuimica logo

CAS 1310405-36-7

:

1,4-Dimethyl-1H-indazole-5-boronic acid

Description:
1,4-Dimethyl-1H-indazole-5-boronic acid is an organic compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of two methyl groups at the 1 and 4 positions of the indazole ring contributes to its hydrophobic characteristics, while the boronic acid functional group at the 5 position introduces reactivity, particularly in forming reversible covalent bonds with diols. This compound is often utilized in medicinal chemistry and materials science due to its ability to participate in Suzuki-Miyaura cross-coupling reactions, making it valuable for synthesizing complex organic molecules. Additionally, the boronic acid moiety can serve as a ligand in coordination chemistry and has applications in sensor technology. The compound is typically solid at room temperature and may exhibit solubility in polar organic solvents. Its reactivity and structural features make it a subject of interest in various research fields, including drug development and organic synthesis.
Formula:C9H11BN2O2
InChI:InChI=1S/C9H11BN2O2/c1-6-7-5-11-12(2)9(7)4-3-8(6)10(13)14/h3-5,13-14H,1-2H3
InChI key:ATHVOUQWKYPARY-UHFFFAOYSA-N
SMILES:B(C1=C(C2=C(C=C1)N(N=C2)C)C)(O)O
Synonyms:
  • (1,4-dimethyl-1H-indazol-5-yl)boronic acid
  • 1,4-Dimethyl-1H-indazole-5-boronic acid(contains varying amounts of Anhydride)
  • 5-Borono-1,4-dimethyl-1H-indazole
  • 1,4-Dimethyl-1H-indazole-5-boronic acid
  • Boronic acid, B-(1,4-dimethyl-1H-indazol-5-yl)-
Found 4 products.