CAS 131052-36-3
:1-(1-methyl-1H-tetrazol-5-yl)methanamine
Description:
1-(1-methyl-1H-tetrazol-5-yl)methanamine, with the CAS number 131052-36-3, is a chemical compound characterized by its tetrazole ring structure, which contributes to its unique properties. This compound features a methanamine group attached to a 1-methyl-1H-tetrazole moiety, making it a nitrogen-rich heterocyclic compound. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the amine functional group. The tetrazole ring is known for its stability and potential applications in pharmaceuticals, particularly as a building block in drug synthesis. Additionally, the compound may display interesting biological activities, which can be attributed to the tetrazole's ability to mimic carboxylic acids in biological systems. Its reactivity can be influenced by the presence of the amine group, allowing for various chemical transformations. Overall, this compound is of interest in both synthetic chemistry and medicinal chemistry due to its structural features and potential applications.
Formula:C3H7N5
InChI:InChI=1/C3H7N5/c1-8-3(2-4)5-6-7-8/h2,4H2,1H3
SMILES:Cn1c(CN)nnn1
Synonyms:- 1H-tetrazole-5-methanamine, 1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.