CAS 131052-47-6

3,5-DIMETHYL-4-ISOXAZOLEMETHANAMINE

Description:

3,5-Dimethyl-4-isoxazoledmethanamine, identified by its CAS number 131052-47-6, is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This compound features two methyl groups at the 3 and 5 positions of the isoxazole ring, contributing to its unique properties and reactivity. The presence of the methanamine functional group indicates that it contains an amine, which can participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, 3,5-Dimethyl-4-isoxazoledmethanamine represents a class of compounds that may have applications in medicinal chemistry and materials science.

Formula: C₆H₁₀N₂O

InChI: InChI=1/C6H10N2O/c1-4-6(3-7)5(2)9-8-4/h3,7H2,1-2H3

SMILES: Cc1c(CN)c(C)on1

Synonyms:

• 4-Aminomethyl-3,5-Dimethylisoxazole
• (3,5-Dimethylisoxazol-4-Yl)Methylamine
• 1-(3,5-Dimethylisoxazol-4-Yl)Methanamine

3,5-DIMETHYL-4-ISOXAZOLEMETHANAMINE

CAS: 131052-47-6

Formula: C₆H₁₀N₂O

Purity: 95%

Color and Shape: Liquid

Molecular weight: 126.1564

Ref: IN-DA0080L7

4-(Aminomethyl)-3,5-dimethylisoxazole

CAS: 131052-47-6

4-(Aminomethyl)-3,5-dimethylisoxazole

Formula: C₆H₁₀N₂O

Purity: 97%

Color and Shape: colourless crystalline powder

Molecular weight: 126.16g/mol

Ref: 54-OR40198

4-Aminomethyl-3,5-dimethylisoxazole

CAS: 131052-47-6

Formula: C₆H₁₀N₂O

Purity: 95%

Color and Shape: Liquid

Molecular weight: 126.159

Ref: 10-F043690