CAS 131052-49-8
:3-(Aminomethyl)-5-methyl-4H-1,2,4-triazole
Description:
3-(Aminomethyl)-5-methyl-4H-1,2,4-triazole, with the CAS number 131052-49-8, is a heterocyclic organic compound characterized by its triazole ring structure, which consists of three nitrogen atoms and two carbon atoms. This compound features an aminomethyl group and a methyl substituent, contributing to its unique chemical properties. It is typically a white to off-white solid and is soluble in polar solvents, which enhances its utility in various applications. The presence of the amino group allows for potential interactions in biological systems, making it of interest in pharmaceutical research, particularly in the development of antifungal agents and other therapeutic compounds. Additionally, its triazole framework is known for its ability to form coordination complexes with metal ions, which can be exploited in catalysis and materials science. Overall, 3-(Aminomethyl)-5-methyl-4H-1,2,4-triazole is a versatile compound with significant implications in both medicinal chemistry and industrial applications.
Formula:C4H8N4
InChI:InChI=1/C4H8N4/c1-3-6-4(2-5)8-7-3/h2,5H2,1H3,(H,6,7,8)
SMILES:Cc1nc(CN)n[nH]1
Synonyms:- 3-Methyl-1H-1,2,4-triazole-5-methanamine
- 1-(5-methyl-1H-1,2,4-triazol-3-yl)methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
