CAS 131052-50-1
:3-(4-Pyridinyl)-1H-1,2,4-triazole-5-methanamine
Description:
3-(4-Pyridinyl)-1H-1,2,4-triazole-5-methanamine, with the CAS number 131052-50-1, is a chemical compound characterized by its unique structure that includes a triazole ring and a pyridine moiety. This compound typically exhibits properties such as moderate solubility in polar solvents, which is common for many nitrogen-containing heterocycles. It may display biological activity, particularly in the realm of pharmaceuticals, due to the presence of the triazole and amine functional groups, which can participate in various chemical interactions. The compound's molecular structure suggests potential applications in medicinal chemistry, possibly as an antifungal or antimicrobial agent, given the known activities of similar triazole derivatives. Additionally, its stability under standard laboratory conditions makes it suitable for further research and development. As with many organic compounds, safety data should be consulted to understand its handling and toxicity profiles. Overall, this compound represents a significant interest in both synthetic and medicinal chemistry fields.
Formula:C8H9N5
InChI:InChI=1S/C8H9N5/c9-5-7-11-8(13-12-7)6-1-3-10-4-2-6/h1-4H,5,9H2,(H,11,12,13)
InChI key:InChIKey=BIZJPAORZHDEEL-UHFFFAOYSA-N
SMILES:C(N)C=1NC(=NN1)C=2C=CN=CC2
Synonyms:- 1H-1,2,4-Triazole-3-methanamine, 5-(4-pyridinyl)-
- [3-(Pyridin-4-yl)-1H-1,2,4-triazol-5-yl]methanamine
- 1H-1,2,4-Triazole-5-methanamine, 3-(4-pyridinyl)-
- 3-(4-Pyridinyl)-1H-1,2,4-triazole-5-methanamine
- [5-(Pyridin-4-yl)-1H-1,2,4-triazol-3-yl]methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.