CAS 131052-62-5
:6-(Aminomethyl)-2(1H)-pyridinone
Description:
6-(Aminomethyl)-2(1H)-pyridinone, with the CAS number 131052-62-5, is an organic compound characterized by its pyridinone structure, which features a pyridine ring with a ketone and an amino group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the amino group. The amino group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. This substance may be of interest in medicinal chemistry, particularly for its potential biological activities, including antimicrobial or anti-inflammatory properties. Its structural features suggest it could act as a ligand in coordination chemistry or as a precursor in the synthesis of more complex organic molecules. Additionally, the presence of both nitrogen and oxygen in its structure may contribute to its ability to form various derivatives, enhancing its utility in research and industrial applications. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C6H8N2O
InChI:InChI=1S/C6H8N2O/c7-4-5-2-1-3-6(9)8-5/h1-3H,4,7H2,(H,8,9)
InChI key:InChIKey=YRZOMHCWFJAZDX-UHFFFAOYSA-N
SMILES:C(N)C=1NC(=O)C=CC1
Synonyms:- 2(1H)-Pyridinone, 6-(aminomethyl)-
- 6-(Aminomethyl)-2(1H)-pyridinone
- 6-(Aminomethyl)Pyridin-2-Ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
