CymitQuimica logo

CAS 1310559-95-5

:

5-Fluoro-2-pyridinyl 1,1,1-trifluoromethanesulfonate

Description:
5-Fluoro-2-pyridinyl 1,1,1-trifluoromethanesulfonate is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a fluorine atom and a trifluoromethanesulfonate group. This compound is typically used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its reactivity and ability to act as a sulfonate leaving group. The presence of multiple fluorine atoms enhances its electrophilic properties, making it a valuable intermediate in various chemical reactions. Additionally, the trifluoromethanesulfonate moiety contributes to its stability and solubility in polar solvents. As with many fluorinated compounds, it may exhibit distinct physical properties, such as increased lipophilicity and altered boiling and melting points compared to non-fluorinated analogs. Safety data should be consulted, as fluorinated compounds can pose specific health and environmental risks. Overall, 5-Fluoro-2-pyridinyl 1,1,1-trifluoromethanesulfonate is an important compound in synthetic chemistry with applications in various fields.
Formula:C6H3F4NO3S
InChI:InChI=1S/C6H3F4NO3S/c7-4-1-2-5(11-3-4)14-15(12,13)6(8,9)10/h1-3H
InChI key:InChIKey=AGZLPEKIEDZQBF-UHFFFAOYSA-N
SMILES:O(S(C(F)(F)F)(=O)=O)C1=CC=C(F)C=N1
Synonyms:
  • Methanesulfonic acid, 1,1,1-trifluoro-, 5-fluoro-2-pyridinyl ester
  • 5-Fluoro-2-pyridinyl 1,1,1-trifluoromethanesulfonate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.