
CAS 1310567-99-7
:(2E)-3-(3-Bromo-2-thienyl)-2-propenoic acid
Description:
(2E)-3-(3-Bromo-2-thienyl)-2-propenoic acid is an organic compound characterized by its unique structure, which includes a propenoic acid moiety and a brominated thienyl group. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitutions. The thienyl ring contributes to the compound's aromaticity and can influence its electronic properties, enhancing its potential applications in organic synthesis and materials science. This compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic thienyl component, while the carboxylic acid group may impart some polar characteristics. Its structural features suggest potential uses in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Additionally, the compound's reactivity and stability can be influenced by environmental factors such as pH and temperature, which are important considerations in its handling and application. Overall, (2E)-3-(3-Bromo-2-thienyl)-2-propenoic acid represents a versatile compound with interesting chemical properties.
Formula:C7H5BrO2S
InChI:InChI=1S/C7H5BrO2S/c8-5-3-4-11-6(5)1-2-7(9)10/h1-4H,(H,9,10)/b2-1+
InChI key:InChIKey=WSVBRXILDIUXOA-OWOJBTEDSA-N
SMILES:C(=C/C(O)=O)\C1=C(Br)C=CS1
Synonyms:- 2-Propenoic acid, 3-(3-bromo-2-thienyl)-, (2E)-
- (2E)-3-(3-Bromo-2-thienyl)-2-propenoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.