CAS 1310680-22-8

4-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-4-methylpentanoic acid

Description:

4-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-4-methylpentanoic acid, commonly referred to as Fmoc-amino acid, is a synthetic compound primarily used in peptide synthesis and drug development. This substance features a fluorenylmethoxycarbonyl (Fmoc) protecting group, which is widely utilized in solid-phase peptide synthesis due to its stability under basic conditions and ease of removal under acidic conditions. The molecule contains an amino group, a carboxylic acid group, and a branched aliphatic chain, contributing to its unique properties. Its structure allows for the formation of peptide bonds, making it essential in the construction of peptides and proteins. The presence of the Fmoc group enhances the solubility and stability of the amino acid during synthesis. Additionally, the compound's characteristics, such as melting point, solubility, and reactivity, are influenced by its functional groups and overall molecular structure. As with many synthetic compounds, proper handling and storage are crucial to maintain its integrity and effectiveness in laboratory applications.

Formula: C₂₁H₂₃NO₄

InChI: InChI=1S/C21H23NO4/c1-21(2,12-11-19(23)24)22-20(25)26-13-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h3-10,18H,11-13H2,1-2H3,(H,22,25)(H,23,24)

InChI key: InChIKey=RDLJKFZZRXLVOY-UHFFFAOYSA-N

SMILES: C(OC(NC(CCC(O)=O)(C)C)=O)C1C=2C(C=3C1=CC=CC3)=CC=CC2

Synonyms:

• 4-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-4-methylpentanoic acid
• Pentanoic acid, 4-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-4-methyl-

Fmoc-4-amino-4-methyl-pentanoic acid

CAS: 1310680-22-8

Purity: 99.0%

Molecular weight: 353.4179992675781

Ref: 10-F494297

4-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-methylpentanoic acid

CAS: 1310680-22-8

Versatile small molecule scaffold

Formula: C₂₁H₂₃NO₄

Purity: Min. 95%

Molecular weight: 353.4 g/mol

Ref: 3D-KCC68022