CAS 1310680-29-5
:(3R)-3-[[(1,1-Dimethylethoxy)carbonyl]amino]-4,4,4-trifluorobutanoic acid
Description:
The chemical substance known as (3R)-3-[[(1,1-Dimethylethoxy)carbonyl]amino]-4,4,4-trifluorobutanoic acid, with the CAS number 1310680-29-5, is an amino acid derivative characterized by the presence of a trifluorobutanoic acid moiety and a dimethylethoxycarbonyl group. This compound features a chiral center at the 3-position, indicating that it exists in a specific stereoisomeric form, which can influence its biological activity and interactions. The trifluoromethyl group contributes to its lipophilicity and may enhance its potency in biological systems. The dimethylethoxycarbonyl group serves as a protective or modifying group, which can be important in synthetic applications or in the development of pharmaceuticals. The presence of both acidic and basic functional groups suggests that this compound can participate in various chemical reactions, including peptide bond formation and other coupling reactions. Overall, this substance is of interest in medicinal chemistry and drug development due to its unique structural features and potential biological applications.
Formula:C9H14F3NO4
InChI:InChI=1S/C9H14F3NO4/c1-8(2,3)17-7(16)13-5(4-6(14)15)9(10,11)12/h5H,4H2,1-3H3,(H,13,16)(H,14,15)/t5-/m1/s1
InChI key:InChIKey=DIEZKLWJBOJOBE-RXMQYKEDSA-N
SMILES:[C@@H](NC(OC(C)(C)C)=O)(CC(O)=O)C(F)(F)F
Synonyms:- Butanoic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]-4,4,4-trifluoro-, (3R)-
- (3R)-3-[[(1,1-Dimethylethoxy)carbonyl]amino]-4,4,4-trifluorobutanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(R)-Boc-3-amino-4,4,4-trifluorobutyric acid
CAS:<p>(R)-Boc-3-amino-4,4,4-trifluorobutyric acid</p>Molecular weight:257.21g/mol
