CAS 1310680-37-5: α-[[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]methyl]-1-naphthaleneacetic acid

Description:α-[[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]methyl]-1-naphthaleneacetic acid, commonly referred to as Fmoc-amino acid derivative, is a synthetic compound primarily used in peptide synthesis and drug development. This substance features a naphthaleneacetic acid moiety, which contributes to its hydrophobic characteristics, while the fluorenylmethoxycarbonyl (Fmoc) group serves as a protective group for amino acids during synthesis. The Fmoc group is known for its stability under basic conditions and can be removed under mild acidic conditions, making it advantageous in solid-phase peptide synthesis. The compound exhibits good solubility in organic solvents, which facilitates its use in various chemical reactions. Its structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of both aromatic and carboxylic acid functionalities suggests potential for π-π stacking interactions and hydrogen bonding, which can influence its biological activity and binding properties. Overall, this compound is significant in the field of organic chemistry and biochemistry for its utility in synthesizing complex peptides.

Formula:C₂₈H₂₃NO₄

InChI:InChI=1S/C28H23NO4/c30-27(31)25(20-15-7-9-18-8-1-2-10-19(18)20)16-29-28(32)33-17-26-23-13-5-3-11-21(23)22-12-4-6-14-24(22)26/h1-15,25-26H,16-17H2,(H,29,32)(H,30,31)

InChI key:InChIKey=WSILPRNTHLWMJU-UHFFFAOYSA-N

SMILES:O=C(OCC1C=2C=CC=CC2C=3C=CC=CC31)NCC(C(=O)O)C4=CC=CC=5C=CC=CC54

Found 3 products.

Product data	Purity	Price range	Estimated delivery
1-Naphthaleneacetic acid, α-[[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]methyl]- REF: IN-DA000VH4CAS: 1310680-37-5	97%	To inquire	Wed 26 Mar 25
3-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-2-(naphthalen-1-yl)propanoic acid REF: 10-F728025CAS: 1310680-37-5	95%	- - -	Discontinued product
(R,S)-Fmoc-3-amino-2-(naphthalen-1-yl)-propionic acid REF: 3D-KCC68037CAS: 1310680-37-5	Min. 95%	- - -	Discontinued product