CAS 1310680-41-1: (2S)-2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-3,3-dimethyl-4-pentenoic acid

Description:The chemical substance known as (2S)-2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-3,3-dimethyl-4-pentenoic acid, with the CAS number 1310680-41-1, is a synthetic compound primarily used in peptide synthesis and as a building block in organic chemistry. It features a chiral center, indicating that it exists in two enantiomeric forms, with the (2S) designation specifying its stereochemistry. The molecule contains a fluorenylmethoxycarbonyl (Fmoc) protecting group, which is commonly employed to protect amines during peptide synthesis, allowing for selective reactions. The presence of a pentenoic acid moiety suggests that it has unsaturation, which can influence its reactivity and interactions. This compound is typically characterized by its solubility in organic solvents, stability under standard laboratory conditions, and potential applications in drug development and biochemistry. Its unique structure and functional groups make it a valuable intermediate in the synthesis of more complex molecules, particularly in the field of medicinal chemistry.

Formula:C₂₂H₂₃NO₄

InChI:InChI=1S/C22H23NO4/c1-4-22(2,3)19(20(24)25)23-21(26)27-13-18-16-11-7-5-9-14(16)15-10-6-8-12-17(15)18/h4-12,18-19H,1,13H2,2-3H3,(H,23,26)(H,24,25)/t19-/m1/s1

InChI key:InChIKey=KSFBTMRFQUMTJS-LJQANCHMSA-N

SMILES:O=C(OCC1C=2C=CC=CC2C=3C=CC=CC31)NC(C(=O)O)C(C=C)(C)C

Synonyms:
(S)-2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-3,3-dimethylpent-4-enoic acid
(2S)-2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-3,3-dimethyl-4-pentenoic acid
4-Pentenoic acid, 2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-3,3-dimethyl-, (2S)-