CAS 1310680-48-8

1-(9H-Fluoren-9-ylmethyl) 4-(2-naphthalenyl)-1,4-piperidinedicarboxylate

Description:

1-(9H-Fluoren-9-ylmethyl) 4-(2-naphthalenyl)-1,4-piperidinedicarboxylate, with the CAS number 1310680-48-8, is a synthetic organic compound characterized by its complex structure, which includes a piperidine ring substituted with two carboxylate groups and aromatic moieties. This compound features a fluorenylmethyl group and a naphthyl group, contributing to its potential applications in medicinal chemistry and material science. The presence of these aromatic systems often imparts significant stability and hydrophobic characteristics, influencing its solubility and reactivity. Additionally, the piperidine ring can participate in various chemical reactions, making it a versatile building block in organic synthesis. The compound's unique structure may also exhibit interesting biological activities, although specific pharmacological data would require further investigation. Overall, its intricate design suggests potential utility in drug development or as a precursor in the synthesis of more complex molecules.

Formula: C₃₁H₂₇NO₄

InChI: InChI=1S/C31H27NO4/c33-29(34)31(23-14-13-21-7-1-2-8-22(21)19-23)15-17-32(18-16-31)30(35)36-20-28-26-11-5-3-9-24(26)25-10-4-6-12-27(25)28/h1-14,19,28H,15-18,20H2,(H,33,34)

InChI key: InChIKey=HATIERMRHMDJMR-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(CCN(C(OCC2C=3C(C=4C2=CC=CC4)=CC=CC3)=O)CC1)C5=CC6=C(C=C5)C=CC=C6

Synonyms:

• 1-(9H-Fluoren-9-ylmethyl) 4-(2-naphthalenyl)-1,4-piperidinedicarboxylate
• 1,4-Piperidinedicarboxylic acid, 4-(2-naphthalenyl)-, 1-(9H-fluoren-9-ylmethyl) ester