CAS 1310684-94-6

5-(Difluoromethyl)pyrimidine

Description:

5-(Difluoromethyl)pyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a difluoromethyl group at the 5-position. The presence of the difluoromethyl group introduces unique electronic and steric properties, making this compound of interest in medicinal chemistry and agrochemical applications. Pyrimidines are known for their aromaticity and ability to participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The difluoromethyl group enhances the lipophilicity and metabolic stability of the compound, which can influence its biological activity. Additionally, the compound may exhibit interesting interactions with biological targets due to the presence of fluorine atoms, which can affect hydrogen bonding and molecular recognition. Its synthesis typically involves the introduction of the difluoromethyl group onto the pyrimidine scaffold through various synthetic methodologies. Overall, 5-(Difluoromethyl)pyrimidine is a valuable compound in the development of pharmaceuticals and agrochemicals, with potential applications in various fields of research.

Formula: C₅H₄F₂N₂

InChI: InChI=1S/C5H4F2N2/c6-5(7)4-1-8-3-9-2-4/h1-3,5H

InChI key: InChIKey=QHHDFZKKOOQUHD-UHFFFAOYSA-N

SMILES: C(F)(F)C=1C=NC=NC1

Synonyms:

• 5-(Difluoromethyl)pyrimidine
• Pyrimidine, 5-(difluoromethyl)-