CAS 1310684-96-8

4-(5-Methyl-1,2,4-thiadiazol-3-yl)piperidine

Description:

4-(5-Methyl-1,2,4-thiadiazol-3-yl)piperidine is a chemical compound characterized by its unique structure, which includes a piperidine ring and a thiadiazole moiety. The piperidine portion contributes to its cyclic amine properties, while the thiadiazole ring introduces heteroatoms, enhancing its potential for biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of nitrogen and sulfur atoms. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as thiadiazoles are often associated with various biological activities, including antimicrobial and anti-inflammatory properties. The presence of the methyl group on the thiadiazole ring may influence its lipophilicity and reactivity, making it a candidate for further research in drug design. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Overall, 4-(5-Methyl-1,2,4-thiadiazol-3-yl)piperidine represents a compound of interest in both synthetic and applied chemistry contexts.

Formula: C₈H₁₃N₃S

InChI: InChI=1S/C8H13N3S/c1-6-10-8(11-12-6)7-2-4-9-5-3-7/h7,9H,2-5H2,1H3

InChI key: InChIKey=YHFNQXNTOSFOAS-UHFFFAOYSA-N

SMILES: CC1=NC(=NS1)C2CCNCC2

Synonyms:

• Piperidine, 4-(5-methyl-1,2,4-thiadiazol-3-yl)-
• 4-(5-Methyl-1,2,4-thiadiazol-3-yl)piperidine