CymitQuimica logo

CAS 1310729-92-0

:

S-(3,3-Difluorocyclobutyl) ethanethioate

Description:
S-(3,3-Difluorocyclobutyl) ethanethioate is a chemical compound characterized by its unique structure, which includes a cyclobutane ring substituted with two fluorine atoms and a thioate functional group. This compound is likely to exhibit properties typical of thioesters, such as being susceptible to nucleophilic attack due to the electrophilic nature of the carbonyl carbon. The presence of the difluorocyclobutyl group may impart distinctive physical and chemical properties, including increased lipophilicity and potential reactivity in various chemical reactions. The fluorine atoms can enhance the stability of the compound and influence its interaction with biological systems, making it of interest in medicinal chemistry and agrochemical applications. Additionally, the compound's molecular geometry and steric effects from the cyclobutane ring can affect its reactivity and interaction with other molecules. Overall, S-(3,3-Difluorocyclobutyl) ethanethioate represents a specialized compound with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C6H8F2OS
InChI:InChI=1S/C6H8F2OS/c1-4(9)10-5-2-6(7,8)3-5/h5H,2-3H2,1H3
InChI key:InChIKey=SQZSUTSMLZXHSG-UHFFFAOYSA-N
SMILES:S(C(C)=O)C1CC(F)(F)C1
Synonyms:
  • Ethanethioic acid, S-(3,3-difluorocyclobutyl) ester
  • 1-[(3,3-Difluorocyclobutyl)sulfanyl]ethan-1-one
  • S-(3,3-Difluorocyclobutyl) ethanethioate
  • S-(3,3-Difluorocyclobutyl)ethanethioic acid ester
  • S-(3,3-Difluorocyclobutyl)ethanethioic acid ester - D7007
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.