CAS 1310729-95-3

3-(Aminomethyl)cyclobutanecarboxylic acid

Description:

3-(Aminomethyl)cyclobutanecarboxylic acid is an organic compound characterized by its cyclobutane ring structure, which is a four-membered carbon ring. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH) attached to the cyclobutane, contributing to its classification as an amino acid derivative. The presence of the aminomethyl group indicates that there is a methylene (-CH2-) bridge connecting the amino group to the cyclobutane ring. This structure imparts unique properties, such as potential for hydrogen bonding due to the carboxylic acid and amino functionalities, which can influence its solubility and reactivity. The compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new drugs or as a building block in organic synthesis. Its specific stereochemistry and functional groups can also affect its interactions in biological systems, potentially leading to various applications in medicinal chemistry.

Formula: C₆H₁₁NO₂

InChI: InChI=1S/C6H11NO2/c7-3-4-1-5(2-4)6(8)9/h4-5H,1-3,7H2,(H,8,9)

InChI key: InChIKey=INKSBOBJGZMVTL-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CC(CN)C1

Synonyms:

• 3-(Aminomethyl)cyclobutanecarboxylic acid
• Cyclobutanecarboxylic acid, 3-(aminomethyl)-