CAS 131073-49-9
:3-(1-Phenyl-1H-pyrazol-5-yl)-1,2,3-benzotriazin-4(3H)-one
Description:
3-(1-Phenyl-1H-pyrazol-5-yl)-1,2,3-benzotriazin-4(3H)-one is a chemical compound characterized by its complex structure, which includes a benzotriazine core and a phenyl-substituted pyrazole moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential stability under standard laboratory conditions. It may display biological activity, making it of interest in medicinal chemistry and drug development. The presence of both the pyrazole and benzotriazine rings suggests potential interactions with biological targets, possibly influencing its pharmacological profile. Additionally, the compound may participate in various chemical reactions due to the functional groups present, which could be leveraged in synthetic applications. Its specific reactivity and interactions would depend on the surrounding conditions, such as pH and temperature. Overall, this compound represents a class of heterocyclic compounds that are often studied for their diverse applications in pharmaceuticals and materials science.
Formula:C16H11N5O
InChI:InChI=1/C16H11N5O/c22-16-13-8-4-5-9-14(13)18-19-21(16)15-10-11-17-20(15)12-6-2-1-3-7-12/h1-11H
Synonyms:- BRN 3621121
- 1,2,3-Benzotriazin-4(3H)-one, 3-(1-phenyl-1H-pyrazol-5-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(1-Phenyl-1H-pyrazol-5-yl)benzo[d][1,2,3]triazin-4(3H)-one
CAS:Formula:C16H11N5OMolecular weight:289.2914
