CAS 131077-98-0
:(2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-(difluoromethyl)oxolane-3,4-diol
Description:
The chemical substance known as "(2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-(difluoromethyl)oxolane-3,4-diol," with the CAS number 131077-98-0, is a nucleoside analog that exhibits structural features characteristic of both purine and sugar moieties. This compound contains a difluoromethyl group, which can influence its biological activity and stability. The stereochemistry indicated by the (2R,3R,4S,5S) configuration suggests specific spatial arrangements of its atoms, which are crucial for its interaction with biological targets, such as enzymes or receptors. The presence of the amino group on the purine ring enhances its potential for hydrogen bonding, which is significant for its role in biochemical processes. Additionally, the oxolane ring contributes to the overall rigidity and conformation of the molecule, affecting its pharmacokinetic properties. Such compounds are often investigated for their antiviral or anticancer properties, as they can interfere with nucleic acid synthesis. Overall, this substance represents a complex interplay of structural features that may confer unique biological activities.
Formula:C10H11F2N5O3
InChI:InChI=1/C10H11F2N5O3/c11-7(12)6-4(18)5(19)10(20-6)17-2-16-3-8(13)14-1-15-9(3)17/h1-2,4-7,10,18-19H,(H2,13,14,15)/t4-,5+,6-,10+/m0/s1
Synonyms:- 5'-Deoxy-5'-Difluoroadenosine
- 5'-Deoxy-5',5'-Difluoroadenosine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
