CAS 13108-19-5
:10-Aminodecanoic acid
Description:
10-Aminodecanoic acid, also known as decanoic acid-10-amino or simply 10-amino capric acid, is an amino acid with a straight-chain structure consisting of a ten-carbon aliphatic chain and an amino group (-NH2) at the terminal position. It is classified as a non-proteinogenic amino acid, meaning it is not incorporated into proteins during translation. This compound is typically a white crystalline solid at room temperature and is soluble in water due to the presence of the amino group, which can engage in hydrogen bonding. Its molecular formula is C10H21NO2, and it features both carboxylic acid and amine functional groups, which contribute to its amphipathic nature. 10-Aminodecanoic acid has potential applications in the synthesis of polyamides and other polymers, as well as in the development of surfactants and emulsifiers. Additionally, it may exhibit biological activity, making it of interest in pharmaceutical and biochemical research. Proper handling and storage are essential, as with many chemical substances, to ensure safety and stability.
Formula:C10H21NO2
InChI:InChI=1S/C10H21NO2/c11-9-7-5-3-1-2-4-6-8-10(12)13/h1-9,11H2,(H,12,13)
InChI key:InChIKey=XAUQWYHSQICPAZ-UHFFFAOYSA-N
SMILES:C(CCCCCN)CCCC(O)=O
Synonyms:- 10-Aminodecanoic acid
- Decanoic acid, 10-amino-
- ω-Aminodecanoic acid
- 10-Aminodecanic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ref: IN-DA000VIA
1g63.00€5g196.00€10g262.00€25g693.00€50gTo inquire100gTo inquire100mg25.00€250mg28.00€10-Aminodecanoic acid
CAS:10-Aminodecanoic acid is an organic compound that belongs to the group of fatty acids. It is a monomeric molecule with two carboxylic acid groups and one hydroxyl group. 10-Aminodecanoic acid has been shown to induce tumor regression in xenograft models for human prostate, breast, and colon cancer cells. The mechanism of action is currently unclear but may be due to specific interactions with amino acids on glycoproteins or amides on proteins. 10-Aminodecanoic acid also stabilizes membranes by forming hydrogen bonds with phospholipids.
Formula:C10H21NO2Purity:Min. 95%Color and Shape:White PowderMolecular weight:187.28 g/mol10-Aminodecanoic acid
CAS:10-Aminodecanoic acid is an alkane chain featuring terminal carboxylic acid and amino groups. This compound serves as a PROTAC linker in PROTAC synthesis and other conjugation applications. The amino group (NH2) can react with carboxylic acids, activated NHS esters, and carbonyls (ketones, aldehydes), while the terminal carboxylic acid can react with primary amines of activated NHS esters to form stable amide bonds.Formula:C10H21NO2Color and Shape:SolidMolecular weight:187.279





