
CAS 1310836-06-6
:4-Ethyl-5-(3-methyl-2-furanyl)-1H-pyrazol-3-amine
Description:
4-Ethyl-5-(3-methyl-2-furanyl)-1H-pyrazol-3-amine is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features an ethyl group and a 3-methyl-2-furanyl substituent, contributing to its unique chemical properties. The presence of the furanyl group, derived from furan, imparts aromatic characteristics and potential reactivity due to its electron-rich nature. The amine functional group indicates that the compound can engage in hydrogen bonding, influencing its solubility and reactivity. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry. The molecular structure suggests potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require empirical investigation. As with many organic compounds, its stability, reactivity, and interactions with other substances would depend on environmental conditions such as pH, temperature, and the presence of solvents or catalysts.
Formula:C10H13N3O
InChI:InChI=1S/C10H13N3O/c1-3-7-8(12-13-10(7)11)9-6(2)4-5-14-9/h4-5H,3H2,1-2H3,(H3,11,12,13)
InChI key:InChIKey=OCVQRGAHACEBGB-UHFFFAOYSA-N
SMILES:C(C)C1=C(NN=C1N)C2=C(C)C=CO2
Synonyms:- 4-Ethyl-5-(3-methyl-2-furanyl)-1H-pyrazol-3-amine
- 1H-Pyrazol-3-amine, 4-ethyl-5-(3-methyl-2-furanyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.