
CAS 131088-58-9
:1-Pentadecen-3-one
Description:
1-Pentadecen-3-one, with the CAS number 131088-58-9, is an unsaturated ketone characterized by a long carbon chain, specifically containing 15 carbon atoms. It features a double bond located between the first and second carbon atoms, and a ketone functional group at the third carbon. This compound is typically a colorless to pale yellow liquid with a distinctive odor, which may vary depending on its purity and specific isomeric form. Its molecular structure contributes to its reactivity, making it useful in organic synthesis and as a potential intermediate in the production of various chemical compounds. The presence of the double bond imparts certain physical properties, such as lower boiling points compared to saturated counterparts. Additionally, 1-pentadecen-3-one may exhibit biological activity, which could be of interest in fields such as fragrance formulation or agrochemicals. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C15H28O
InChI:InChI=1S/C15H28O/c1-3-5-6-7-8-9-10-11-12-13-14-15(16)4-2/h4H,2-3,5-14H2,1H3
InChI key:InChIKey=YFURFLWAOAZPGU-UHFFFAOYSA-N
SMILES:C(CCC(C=C)=O)CCCCCCCCC
Synonyms:- 1-Pentadecen-3-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
