CAS 13110-25-3
:beta-aspartylalanine
Description:
Beta-aspartylalanine, with the CAS number 13110-25-3, is a dipeptide composed of the amino acids aspartic acid and alanine. It is characterized by its unique structure, where the aspartic acid is linked to alanine through a peptide bond. This compound is typically found in various biological systems and can play a role in metabolic processes. Beta-aspartylalanine is known for its potential applications in biochemistry and nutrition, particularly in studies related to peptide synthesis and amino acid metabolism. It is generally soluble in water, which is a common characteristic of many peptides, and may exhibit specific biological activities, although detailed studies on its pharmacological properties are limited. The compound's stability and reactivity can be influenced by factors such as pH and temperature, making it important to consider these conditions in experimental settings. Overall, beta-aspartylalanine serves as an interesting subject for research in peptide chemistry and its implications in biological systems.
Formula:C7H12N2O5
InChI:InChI=1/C7H12N2O5/c1-3(6(11)12)9-5(10)2-4(8)7(13)14/h3-4H,2,8H2,1H3,(H,9,10)(H,11,12)(H,13,14)/t3-,4-/m0/s1
SMILES:C[C@@H](C(=O)O)N=C(C[C@@H](C(=O)O)N)O
Synonyms:- L-Alanine, N-L-beta-aspartyl-
- L-beta-aspartyl-L-alanine
- beta-Aspartylalanine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
H-Asp(Ala-OH)-OH
CAS:Substrate for bacterial β-aspartylpeptidase.Formula:C7H12N2O5Purity:> 99%Color and Shape:White PowderMolecular weight:204.18H-Asp(Ala-OH)-OH
CAS:H-Asp(Ala-OH)-OH is an amino acid that has been found to be selectively active in the cerebral cortex. It has a high affinity for the cerebral cortex, with a Kd of 1.5 nM and a brain tissue concentration of 3.3 µg/g. H-Asp(Ala-OH)-OH has been shown to have neuroprotective effects against hypoxia, glutamate toxicity, and oxygen deprivation. This compound reverses the effects of oxidative stress in cultured cells and can also stimulate protein synthesis in cultured cells. The mechanism by which it works is not yet known but may involve inhibition of cysteine uptake into the cell or stimulation of protein synthesis by increasing intracellular levels of cAMP.Formula:C7H12N2O5Purity:Min. 95 Area-%Color and Shape:White PowderMolecular weight:204.18 g/molβ-Aspartylalanine
CAS:Controlled ProductFormula:C7H12N2O5Color and Shape:NeatMolecular weight:204.181


